C24H30Cl4N4O8S2 — CID 70378311
bis[2,4-dichloro-6-[3-(dimethylamino)propylsulfamoyl]phenyl] oxalate (PubChem CID 70378311) has the molecular formula C24H30Cl4N4O8S2 and a molecular weight of 708.47 g/mol. Its IUPAC name is bis[2,4-dichloro-6-[3-(dimethylamino)propylsulfamoyl]phenyl] oxalate.
| Compound Name | bis[2,4-dichloro-6-[3-(dimethylamino)propylsulfamoyl]phenyl] oxalate |
|---|---|
| PubChem CID | 70378311 |
| Molecular Formula | C24H30Cl4N4O8S2 |
| Molecular Weight | 708.47 g/mol |
| Exact Mass | 706.03 |
| IUPAC Name | bis[2,4-dichloro-6-[3-(dimethylamino)propylsulfamoyl]phenyl] oxalate |
| SMILES | CN(C)CCCNS(=O)(=O)c1cc(Cl)cc(Cl)c1OC(=O)C(=O)Oc1c(Cl)cc(Cl)cc1S(=O)(=O)NCCCN(C)C |
| InChI | InChI=1S/C24H30Cl4N4O8S2/c1-31(2)9-5-7-29-41(35,36)19-13-15(25)11-17(27)21(19)39-23(33)24(34)40-22-18(28)12-16(26)14-20(22)42(37,38)30-8-6-10-32(3)4/h11-14,29-30H,5-10H2,1-4H3 |
| InChIKey | QRVDVIDRACOTKI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|