C12H11ClN4O4S — CID 2777388
4-chloro-N,N-bis(2-cyanoethyl)-3-nitrobenzenesulfonamide (PubChem CID 2777388) has the molecular formula C12H11ClN4O4S and a molecular weight of 342.76 g/mol. Its IUPAC name is 4-chloro-N,N-bis(2-cyanoethyl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-chloro-N,N-bis(2-cyanoethyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 2777388 |
| Molecular Formula | C12H11ClN4O4S |
| Molecular Weight | 342.76 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 4-chloro-N,N-bis(2-cyanoethyl)-3-nitrobenzenesulfonamide |
| SMILES | N#CCCN(CCC#N)S(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H11ClN4O4S/c13-11-4-3-10(9-12(11)17(18)19)22(20,21)16(7-1-5-14)8-2-6-15/h3-4,9H,1-2,7-8H2 |
| InChIKey | AQWMRWWYEAOMJA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 128.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.76 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|