C12H19N3O5S — CID 62146185
N-ethyl-4-(ethylamino)-N-(2-hydroxyethyl)-2-nitrobenzenesulfonamide (PubChem CID 62146185) has the molecular formula C12H19N3O5S and a molecular weight of 317.37 g/mol. Its IUPAC name is N-ethyl-4-(ethylamino)-N-(2-hydroxyethyl)-2-nitrobenzenesulfonamide.
| Compound Name | N-ethyl-4-(ethylamino)-N-(2-hydroxyethyl)-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 62146185 |
| Molecular Formula | C12H19N3O5S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | N-ethyl-4-(ethylamino)-N-(2-hydroxyethyl)-2-nitrobenzenesulfonamide |
| SMILES | CCNc1ccc(S(=O)(=O)N(CC)CCO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H19N3O5S/c1-3-13-10-5-6-12(11(9-10)15(17)18)21(19,20)14(4-2)7-8-16/h5-6,9,13,16H,3-4,7-8H2,1-2H3 |
| InChIKey | BMQPCXIRVGJBAY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|