C14H14ClN3O4S — CID 47084790
4-chloro-N-methyl-2-nitro-N-(2-pyridin-4-ylethyl)benzenesulfonamide (PubChem CID 47084790) has the molecular formula C14H14ClN3O4S and a molecular weight of 355.80 g/mol. Its IUPAC name is 4-chloro-N-methyl-2-nitro-N-(2-pyridin-4-ylethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-methyl-2-nitro-N-(2-pyridin-4-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 47084790 |
| Molecular Formula | C14H14ClN3O4S |
| Molecular Weight | 355.80 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 4-chloro-N-methyl-2-nitro-N-(2-pyridin-4-ylethyl)benzenesulfonamide |
| SMILES | CN(CCc1ccncc1)S(=O)(=O)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H14ClN3O4S/c1-17(9-6-11-4-7-16-8-5-11)23(21,22)14-3-2-12(15)10-13(14)18(19)20/h2-5,7-8,10H,6,9H2,1H3 |
| InChIKey | LNGFUMJDIAAQFT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 93.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.80 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|