C12H17Cl2N3O4S — CID 119965865
4-chloro-N-methyl-2-nitro-N-piperidin-4-ylbenzenesulfonamide;hydrochloride (PubChem CID 119965865) has the molecular formula C12H17Cl2N3O4S and a molecular weight of 370.26 g/mol. Its IUPAC name is 4-chloro-N-methyl-2-nitro-N-piperidin-4-ylbenzenesulfonamide;hydrochloride.
| Compound Name | 4-chloro-N-methyl-2-nitro-N-piperidin-4-ylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119965865 |
| Molecular Formula | C12H17Cl2N3O4S |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 4-chloro-N-methyl-2-nitro-N-piperidin-4-ylbenzenesulfonamide;hydrochloride |
| SMILES | CN(C1CCNCC1)S(=O)(=O)c1ccc(Cl)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C12H16ClN3O4S.ClH/c1-15(10-4-6-14-7-5-10)21(19,20)12-3-2-9(13)8-11(12)16(17)18;/h2-3,8,10,14H,4-7H2,1H3;1H |
| InChIKey | NETLJZGHZBSZLP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|