C14H18ClN3O2S — CID 107172940
N-(azepan-4-yl)-5-chloro-2-cyano-N-methylbenzenesulfonamide (PubChem CID 107172940) has the molecular formula C14H18ClN3O2S and a molecular weight of 327.84 g/mol. Its IUPAC name is N-(azepan-4-yl)-5-chloro-2-cyano-N-methylbenzenesulfonamide.
| Compound Name | N-(azepan-4-yl)-5-chloro-2-cyano-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 107172940 |
| Molecular Formula | C14H18ClN3O2S |
| Molecular Weight | 327.84 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | N-(azepan-4-yl)-5-chloro-2-cyano-N-methylbenzenesulfonamide |
| SMILES | CN(C1CCCNCC1)S(=O)(=O)c1cc(Cl)ccc1C#N |
| InChI | InChI=1S/C14H18ClN3O2S/c1-18(13-3-2-7-17-8-6-13)21(19,20)14-9-12(15)5-4-11(14)10-16/h4-5,9,13,17H,2-3,6-8H2,1H3 |
| InChIKey | WHLYAUGPEVSGIP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.84 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |