C13H22N2O2S2 — CID 107173135
N-(azepan-4-yl)-N,2,5-trimethylthiophene-3-sulfonamide (PubChem CID 107173135) has the molecular formula C13H22N2O2S2 and a molecular weight of 302.46 g/mol. Its IUPAC name is N-(azepan-4-yl)-N,2,5-trimethylthiophene-3-sulfonamide.
| Compound Name | N-(azepan-4-yl)-N,2,5-trimethylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 107173135 |
| Molecular Formula | C13H22N2O2S2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-(azepan-4-yl)-N,2,5-trimethylthiophene-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)C2CCCNCC2)c(C)s1 |
| InChI | InChI=1S/C13H22N2O2S2/c1-10-9-13(11(2)18-10)19(16,17)15(3)12-5-4-7-14-8-6-12/h9,12,14H,4-8H2,1-3H3 |
| InChIKey | MJACAQWSXGZREH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |