C11H15ClF2N2O3S — CID 115319094
N-(3-aminopropyl)-3-chloro-4-(difluoromethoxy)-N-methylbenzenesulfonamide (PubChem CID 115319094) has the molecular formula C11H15ClF2N2O3S and a molecular weight of 328.77 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-chloro-4-(difluoromethoxy)-N-methylbenzenesulfonamide.
| Compound Name | N-(3-aminopropyl)-3-chloro-4-(difluoromethoxy)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 115319094 |
| Molecular Formula | C11H15ClF2N2O3S |
| Molecular Weight | 328.77 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | N-(3-aminopropyl)-3-chloro-4-(difluoromethoxy)-N-methylbenzenesulfonamide |
| SMILES | CN(CCCN)S(=O)(=O)c1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C11H15ClF2N2O3S/c1-16(6-2-5-15)20(17,18)8-3-4-10(9(12)7-8)19-11(13)14/h3-4,7,11H,2,5-6,15H2,1H3 |
| InChIKey | SZOAYEBWSRXBCT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.77 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |