C10H12ClF3N2O2S — CID 62058073
3-amino-4-chloro-N-methyl-N-(3,3,3-trifluoropropyl)benzenesulfonamide (PubChem CID 62058073) has the molecular formula C10H12ClF3N2O2S and a molecular weight of 316.73 g/mol. Its IUPAC name is 3-amino-4-chloro-N-methyl-N-(3,3,3-trifluoropropyl)benzenesulfonamide.
| Compound Name | 3-amino-4-chloro-N-methyl-N-(3,3,3-trifluoropropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 62058073 |
| Molecular Formula | C10H12ClF3N2O2S |
| Molecular Weight | 316.73 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 3-amino-4-chloro-N-methyl-N-(3,3,3-trifluoropropyl)benzenesulfonamide |
| SMILES | CN(CCC(F)(F)F)S(=O)(=O)c1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C10H12ClF3N2O2S/c1-16(5-4-10(12,13)14)19(17,18)7-2-3-8(11)9(15)6-7/h2-3,6H,4-5,15H2,1H3 |
| InChIKey | IWQICFHGCSMCTA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.73 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|