C10H9Cl2FN2O5S — CID 103087667
(2S)-4-amino-2-[(2,4-dichloro-3-fluorophenyl)sulfonylamino]-4-oxobutanoic acid (PubChem CID 103087667) has the molecular formula C10H9Cl2FN2O5S and a molecular weight of 359.16 g/mol. Its IUPAC name is (2S)-4-amino-2-[(2,4-dichloro-3-fluorophenyl)sulfonylamino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[(2,4-dichloro-3-fluorophenyl)sulfonylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 103087667 |
| Molecular Formula | C10H9Cl2FN2O5S |
| Molecular Weight | 359.16 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | (2S)-4-amino-2-[(2,4-dichloro-3-fluorophenyl)sulfonylamino]-4-oxobutanoic acid |
| SMILES | NC(=O)C[C@H](NS(=O)(=O)c1ccc(Cl)c(F)c1Cl)C(=O)O |
| InChI | InChI=1S/C10H9Cl2FN2O5S/c11-4-1-2-6(8(12)9(4)13)21(19,20)15-5(10(17)18)3-7(14)16/h1-2,5,15H,3H2,(H2,14,16)(H,17,18)/t5-/m0/s1 |
| InChIKey | VMSIRRCNRDBHPL-YFKPBYRVSA-N |
| XLogP | 0.74 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.16 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|