C11H10ClN3O5S — CID 80696808
(2S)-4-amino-2-[(2-chloro-5-cyanophenyl)sulfonylamino]-4-oxobutanoic acid (PubChem CID 80696808) has the molecular formula C11H10ClN3O5S and a molecular weight of 331.74 g/mol. Its IUPAC name is (2S)-4-amino-2-[(2-chloro-5-cyanophenyl)sulfonylamino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[(2-chloro-5-cyanophenyl)sulfonylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 80696808 |
| Molecular Formula | C11H10ClN3O5S |
| Molecular Weight | 331.74 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | (2S)-4-amino-2-[(2-chloro-5-cyanophenyl)sulfonylamino]-4-oxobutanoic acid |
| SMILES | N#Cc1ccc(Cl)c(S(=O)(=O)N[C@@H](CC(N)=O)C(=O)O)c1 |
| InChI | InChI=1S/C11H10ClN3O5S/c12-7-2-1-6(5-13)3-9(7)21(19,20)15-8(11(17)18)4-10(14)16/h1-3,8,15H,4H2,(H2,14,16)(H,17,18)/t8-/m0/s1 |
| InChIKey | MURKMUAWRKWIGS-QMMMGPOBSA-N |
| XLogP | -0.18 |
| TPSA | 150.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.74 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |