About 3-[(3,4-dimethylphenyl)sulfonylamino]-N'-hydroxypentanimidamide
3-[(3,4-dimethylphenyl)sulfonylamino]-N'-hydroxypentanimidamide (PubChem CID 76947675) has the molecular formula C13H21N3O3S
and a molecular weight of 299.40 g/mol. Its IUPAC name is 3-[(3,4-dimethylphenyl)sulfonylamino]-N'-hydroxypentanimidamide.
Molecular Properties
| Compound Name | 3-[(3,4-dimethylphenyl)sulfonylamino]-N'-hydroxypentanimidamide |
| PubChem CID | 76947675 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 3-[(3,4-dimethylphenyl)sulfonylamino]-N'-hydroxypentanimidamide |
| SMILES | CCC(CC(N)=NO)NS(=O)(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C13H21N3O3S/c1-4-11(8-13(14)15-17)16-20(18,19)12-6-5-9(2)10(3)7-12/h5-7,11,16-17H,4,8H2,1-3H3,(H2,14,15) |
| InChIKey | YWAWCFVUVFQASL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3,4-dimethylphenyl)sulfonylamino]-N'-hydroxypentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,4-dimethylphenyl)sulfonylamino]-N'-hydroxypentanimidamide?
The IUPAC name of 3-[(3,4-dimethylphenyl)sulfonylamino]-N'-hydroxypentanimidamide (CID 76947675) is 3-[(3,4-dimethylphenyl)sulfonylamino]-N'-hydroxypentanimidamide.
What is the SMILES notation for 3-[(3,4-dimethylphenyl)sulfonylamino]-N'-hydroxypentanimidamide?
The canonical SMILES for 3-[(3,4-dimethylphenyl)sulfonylamino]-N'-hydroxypentanimidamide is CCC(CC(N)=NO)NS(=O)(=O)c1ccc(C)c(C)c1.
What is the InChIKey of 3-[(3,4-dimethylphenyl)sulfonylamino]-N'-hydroxypentanimidamide?
The InChIKey is YWAWCFVUVFQASL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O3S/c1-4-11(8-13(14)15-17)16-20(18,19)12-6-5-9(2)10(3)7-12/h5-7,11,16-17H,4,8H2,1-3H3,(H2,14,15).
What are the key properties of 3-[(3,4-dimethylphenyl)sulfonylamino]-N'-hydroxypentanimidamide?
3-[(3,4-dimethylphenyl)sulfonylamino]-N'-hydroxypentanimidamide has a molecular weight of 299.40 g/mol, XLogP of 1.50, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,4-dimethylphenyl)sulfonylamino]-N'-hydroxypentanimidamide is sourced from PubChem (CID 76947675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).