C26H30N4O3S — CID 137313541
6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-(1H-indol-3-yl)piperidin-1-yl]hexan-1-one (PubChem CID 137313541) has the molecular formula C26H30N4O3S and a molecular weight of 478.62 g/mol. Its IUPAC name is 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-(1H-indol-3-yl)piperidin-1-yl]hexan-1-one.
| Compound Name | 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-(1H-indol-3-yl)piperidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 137313541 |
| Molecular Formula | C26H30N4O3S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-(1H-indol-3-yl)piperidin-1-yl]hexan-1-one |
| SMILES | O=C(CCCCC/N=C1\NS(=O)(=O)c2ccccc21)N1CCC(c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C26H30N4O3S/c31-25(30-16-13-19(14-17-30)22-18-28-23-10-5-3-8-20(22)23)12-2-1-7-15-27-26-21-9-4-6-11-24(21)34(32,33)29-26/h3-6,8-11,18-19,28H,1-2,7,12-17H2,(H,27,29) |
| InChIKey | AAHMDWQRGOHAKT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 94.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|