C25H28N4O3S2 — CID 137317923
1-[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexan-1-one (PubChem CID 137317923) has the molecular formula C25H28N4O3S2 and a molecular weight of 496.66 g/mol. Its IUPAC name is 1-[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexan-1-one.
| Compound Name | 1-[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexan-1-one |
|---|---|
| PubChem CID | 137317923 |
| Molecular Formula | C25H28N4O3S2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 1-[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexan-1-one |
| SMILES | O=C(CCCCC/N=C1\NS(=O)(=O)c2ccccc21)N1CCCCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C25H28N4O3S2/c30-23(29-17-9-7-12-20(29)25-27-19-11-4-5-13-21(19)33-25)15-2-1-8-16-26-24-18-10-3-6-14-22(18)34(31,32)28-24/h3-6,10-11,13-14,20H,1-2,7-9,12,15-17H2,(H,26,28) |
| InChIKey | APNSIZPWVVYXAS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|