C20H18N4O3S2 — CID 136784109
1-[(2R)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethanone (PubChem CID 136784109) has the molecular formula C20H18N4O3S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 1-[(2R)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethanone.
| Compound Name | 1-[(2R)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethanone |
|---|---|
| PubChem CID | 136784109 |
| Molecular Formula | C20H18N4O3S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 1-[(2R)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethanone |
| SMILES | O=C(C/N=C1\NS(=O)(=O)c2ccccc21)N1CCC[C@@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H18N4O3S2/c25-18(12-21-19-13-6-1-4-10-17(13)29(26,27)23-19)24-11-5-8-15(24)20-22-14-7-2-3-9-16(14)28-20/h1-4,6-7,9-10,15H,5,8,11-12H2,(H,21,23)/t15-/m1/s1 |
| InChIKey | WTDGGKCNHBEYBF-OAHLLOKOSA-N |
| XLogP | 2.70 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|