C22H25F2N3O3S — CID 137300669
N-[1-(3,4-difluorophenyl)ethyl]-6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-methylhexanamide (PubChem CID 137300669) has the molecular formula C22H25F2N3O3S and a molecular weight of 449.52 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)ethyl]-6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-methylhexanamide.
| Compound Name | N-[1-(3,4-difluorophenyl)ethyl]-6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-methylhexanamide |
|---|---|
| PubChem CID | 137300669 |
| Molecular Formula | C22H25F2N3O3S |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)ethyl]-6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-methylhexanamide |
| SMILES | CC(c1ccc(F)c(F)c1)N(C)C(=O)CCCCC/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C22H25F2N3O3S/c1-15(16-11-12-18(23)19(24)14-16)27(2)21(28)10-4-3-7-13-25-22-17-8-5-6-9-20(17)31(29,30)26-22/h5-6,8-9,11-12,14-15H,3-4,7,10,13H2,1-2H3,(H,25,26) |
| InChIKey | YVZCCJPKQGDCNY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|