C22H24N4O7S — CID 135925606
[2-(2-methyl-4-nitroanilino)-2-oxoethyl] 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate (PubChem CID 135925606) has the molecular formula C22H24N4O7S and a molecular weight of 488.52 g/mol. Its IUPAC name is [2-(2-methyl-4-nitroanilino)-2-oxoethyl] 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate.
| Compound Name | [2-(2-methyl-4-nitroanilino)-2-oxoethyl] 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate |
|---|---|
| PubChem CID | 135925606 |
| Molecular Formula | C22H24N4O7S |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | [2-(2-methyl-4-nitroanilino)-2-oxoethyl] 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)COC(=O)CCCCC/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C22H24N4O7S/c1-15-13-16(26(29)30)10-11-18(15)24-20(27)14-33-21(28)9-3-2-6-12-23-22-17-7-4-5-8-19(17)34(31,32)25-22/h4-5,7-8,10-11,13H,2-3,6,9,12,14H2,1H3,(H,23,25)(H,24,27) |
| InChIKey | JEWYNYMUKOSSSL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 157.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|