C22H26N4O4S — CID 135900292
3-[[6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoylamino]methyl]-N-methylbenzamide (PubChem CID 135900292) has the molecular formula C22H26N4O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is 3-[[6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoylamino]methyl]-N-methylbenzamide.
| Compound Name | 3-[[6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoylamino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 135900292 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 3-[[6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoylamino]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(CNC(=O)CCCCC/N=C2\NS(=O)(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C22H26N4O4S/c1-23-22(28)17-9-7-8-16(14-17)15-25-20(27)12-3-2-6-13-24-21-18-10-4-5-11-19(18)31(29,30)26-21/h4-5,7-11,14H,2-3,6,12-13,15H2,1H3,(H,23,28)(H,24,26)(H,25,27) |
| InChIKey | OFCROFPPCUWAFZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|