C21H25N3O5S2 — CID 135960853
methyl 3-[6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoylamino]-3-thiophen-2-ylpropanoate (PubChem CID 135960853) has the molecular formula C21H25N3O5S2 and a molecular weight of 463.58 g/mol. Its IUPAC name is methyl 3-[6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoylamino]-3-thiophen-2-ylpropanoate.
| Compound Name | methyl 3-[6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoylamino]-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 135960853 |
| Molecular Formula | C21H25N3O5S2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | methyl 3-[6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoylamino]-3-thiophen-2-ylpropanoate |
| SMILES | COC(=O)CC(NC(=O)CCCCC/N=C1\NS(=O)(=O)c2ccccc21)c1cccs1 |
| InChI | InChI=1S/C21H25N3O5S2/c1-29-20(26)14-16(17-9-7-13-30-17)23-19(25)11-3-2-6-12-22-21-15-8-4-5-10-18(15)31(27,28)24-21/h4-5,7-10,13,16H,2-3,6,11-12,14H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | JCWNVOYADCYTND-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|