C20H26Cl2N4O — CID 119836753
2-(4-aminophenyl)-N-[1-(1H-benzimidazol-2-yl)-3-methylbutyl]acetamide;dihydrochloride (PubChem CID 119836753) has the molecular formula C20H26Cl2N4O and a molecular weight of 409.36 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[1-(1H-benzimidazol-2-yl)-3-methylbutyl]acetamide;dihydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-[1-(1H-benzimidazol-2-yl)-3-methylbutyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119836753 |
| Molecular Formula | C20H26Cl2N4O |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 2-(4-aminophenyl)-N-[1-(1H-benzimidazol-2-yl)-3-methylbutyl]acetamide;dihydrochloride |
| SMILES | CC(C)CC(NC(=O)Cc1ccc(N)cc1)c1nc2ccccc2[nH]1.Cl.Cl |
| InChI | InChI=1S/C20H24N4O.2ClH/c1-13(2)11-18(20-23-16-5-3-4-6-17(16)24-20)22-19(25)12-14-7-9-15(21)10-8-14;;/h3-10,13,18H,11-12,21H2,1-2H3,(H,22,25)(H,23,24);2*1H |
| InChIKey | ARFJRUGVINSXOD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|