C17H26N4O — CID 119836762
2-amino-N-[1-(1H-benzimidazol-2-yl)-3-methylbutyl]pentanamide (PubChem CID 119836762) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-amino-N-[1-(1H-benzimidazol-2-yl)-3-methylbutyl]pentanamide.
| Compound Name | 2-amino-N-[1-(1H-benzimidazol-2-yl)-3-methylbutyl]pentanamide |
|---|---|
| PubChem CID | 119836762 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 2-amino-N-[1-(1H-benzimidazol-2-yl)-3-methylbutyl]pentanamide |
| SMILES | CCCC(N)C(=O)NC(CC(C)C)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H26N4O/c1-4-7-12(18)17(22)21-15(10-11(2)3)16-19-13-8-5-6-9-14(13)20-16/h5-6,8-9,11-12,15H,4,7,10,18H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | AWJRDJYRGVESME-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |