C14H25N3OS — CID 81493847
2-[3-aminopropyl(methyl)amino]-N-(2-methyl-1-thiophen-2-ylpropyl)acetamide (PubChem CID 81493847) has the molecular formula C14H25N3OS and a molecular weight of 283.44 g/mol. Its IUPAC name is 2-[3-aminopropyl(methyl)amino]-N-(2-methyl-1-thiophen-2-ylpropyl)acetamide.
| Compound Name | 2-[3-aminopropyl(methyl)amino]-N-(2-methyl-1-thiophen-2-ylpropyl)acetamide |
|---|---|
| PubChem CID | 81493847 |
| Molecular Formula | C14H25N3OS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 2-[3-aminopropyl(methyl)amino]-N-(2-methyl-1-thiophen-2-ylpropyl)acetamide |
| SMILES | CC(C)C(NC(=O)CN(C)CCCN)c1cccs1 |
| InChI | InChI=1S/C14H25N3OS/c1-11(2)14(12-6-4-9-19-12)16-13(18)10-17(3)8-5-7-15/h4,6,9,11,14H,5,7-8,10,15H2,1-3H3,(H,16,18) |
| InChIKey | PPOTVQMNQSFRKO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |