C15H26N2O3S — CID 115613728
2-[2-hydroxyethyl(2-methoxyethyl)amino]-N-(2-methyl-1-thiophen-2-ylpropyl)acetamide (PubChem CID 115613728) has the molecular formula C15H26N2O3S and a molecular weight of 314.45 g/mol. Its IUPAC name is 2-[2-hydroxyethyl(2-methoxyethyl)amino]-N-(2-methyl-1-thiophen-2-ylpropyl)acetamide.
| Compound Name | 2-[2-hydroxyethyl(2-methoxyethyl)amino]-N-(2-methyl-1-thiophen-2-ylpropyl)acetamide |
|---|---|
| PubChem CID | 115613728 |
| Molecular Formula | C15H26N2O3S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 2-[2-hydroxyethyl(2-methoxyethyl)amino]-N-(2-methyl-1-thiophen-2-ylpropyl)acetamide |
| SMILES | COCCN(CCO)CC(=O)NC(c1cccs1)C(C)C |
| InChI | InChI=1S/C15H26N2O3S/c1-12(2)15(13-5-4-10-21-13)16-14(19)11-17(6-8-18)7-9-20-3/h4-5,10,12,15,18H,6-9,11H2,1-3H3,(H,16,19) |
| InChIKey | LAPSYZPJCGNGJC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |