C19H26N2OS — CID 51730175
2-[methyl-[(1R)-1-phenylethyl]amino]-N-[(1S)-2-methyl-1-thiophen-2-ylpropyl]acetamide (PubChem CID 51730175) has the molecular formula C19H26N2OS and a molecular weight of 330.50 g/mol. Its IUPAC name is 2-[methyl-[(1R)-1-phenylethyl]amino]-N-[(1S)-2-methyl-1-thiophen-2-ylpropyl]acetamide.
| Compound Name | 2-[methyl-[(1R)-1-phenylethyl]amino]-N-[(1S)-2-methyl-1-thiophen-2-ylpropyl]acetamide |
|---|---|
| PubChem CID | 51730175 |
| Molecular Formula | C19H26N2OS |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2-[methyl-[(1R)-1-phenylethyl]amino]-N-[(1S)-2-methyl-1-thiophen-2-ylpropyl]acetamide |
| SMILES | CC(C)[C@H](NC(=O)CN(C)[C@H](C)c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C19H26N2OS/c1-14(2)19(17-11-8-12-23-17)20-18(22)13-21(4)15(3)16-9-6-5-7-10-16/h5-12,14-15,19H,13H2,1-4H3,(H,20,22)/t15-,19+/m1/s1 |
| InChIKey | HSSZUDBDTGUJAR-BEFAXECRSA-N |
| XLogP | 4.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |