C17H24N4O — CID 30302557
1-methyl-3-[(1R)-2-methyl-1-phenylpropyl]-1-[(1-methylpyrazol-4-yl)methyl]urea (PubChem CID 30302557) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 1-methyl-3-[(1R)-2-methyl-1-phenylpropyl]-1-[(1-methylpyrazol-4-yl)methyl]urea.
| Compound Name | 1-methyl-3-[(1R)-2-methyl-1-phenylpropyl]-1-[(1-methylpyrazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 30302557 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 1-methyl-3-[(1R)-2-methyl-1-phenylpropyl]-1-[(1-methylpyrazol-4-yl)methyl]urea |
| SMILES | CC(C)[C@@H](NC(=O)N(C)Cc1cnn(C)c1)c1ccccc1 |
| InChI | InChI=1S/C17H24N4O/c1-13(2)16(15-8-6-5-7-9-15)19-17(22)20(3)11-14-10-18-21(4)12-14/h5-10,12-13,16H,11H2,1-4H3,(H,19,22)/t16-/m1/s1 |
| InChIKey | AKZASVHCCYZNCJ-MRXNPFEDSA-N |
| XLogP | 2.96 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |