C10H12BrN3O2S2 — CID 22771399
5-bromo-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]thiophene-2-sulfonamide (PubChem CID 22771399) has the molecular formula C10H12BrN3O2S2 and a molecular weight of 350.26 g/mol. Its IUPAC name is 5-bromo-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22771399 |
| Molecular Formula | C10H12BrN3O2S2 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 348.96 |
| IUPAC Name | 5-bromo-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]thiophene-2-sulfonamide |
| SMILES | CN(Cc1cnn(C)c1)S(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C10H12BrN3O2S2/c1-13-6-8(5-12-13)7-14(2)18(15,16)10-4-3-9(11)17-10/h3-6H,7H2,1-2H3 |
| InChIKey | JQKHBFHVMJILMQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |