C16H21N3O4S2 — CID 30288352
3-N-[[4-(dimethylamino)phenyl]methyl]-3-N-methylbenzene-1,3-disulfonamide (PubChem CID 30288352) has the molecular formula C16H21N3O4S2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 3-N-[[4-(dimethylamino)phenyl]methyl]-3-N-methylbenzene-1,3-disulfonamide.
| Compound Name | 3-N-[[4-(dimethylamino)phenyl]methyl]-3-N-methylbenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 30288352 |
| Molecular Formula | C16H21N3O4S2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 3-N-[[4-(dimethylamino)phenyl]methyl]-3-N-methylbenzene-1,3-disulfonamide |
| SMILES | CN(C)c1ccc(CN(C)S(=O)(=O)c2cccc(S(N)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C16H21N3O4S2/c1-18(2)14-9-7-13(8-10-14)12-19(3)25(22,23)16-6-4-5-15(11-16)24(17,20)21/h4-11H,12H2,1-3H3,(H2,17,20,21) |
| InChIKey | JGVRZMIAKWAJPS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|