C15H18N2O4S2 — CID 31070038
3-N-methyl-3-N-[(2-methylphenyl)methyl]benzene-1,3-disulfonamide (PubChem CID 31070038) has the molecular formula C15H18N2O4S2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 3-N-methyl-3-N-[(2-methylphenyl)methyl]benzene-1,3-disulfonamide.
| Compound Name | 3-N-methyl-3-N-[(2-methylphenyl)methyl]benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 31070038 |
| Molecular Formula | C15H18N2O4S2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 3-N-methyl-3-N-[(2-methylphenyl)methyl]benzene-1,3-disulfonamide |
| SMILES | Cc1ccccc1CN(C)S(=O)(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C15H18N2O4S2/c1-12-6-3-4-7-13(12)11-17(2)23(20,21)15-9-5-8-14(10-15)22(16,18)19/h3-10H,11H2,1-2H3,(H2,16,18,19) |
| InChIKey | BBTVCYJGERSWBY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |