C15H16FNO2S — CID 47103944
N-[(4-fluorophenyl)methyl]-N,3-dimethylbenzenesulfonamide (PubChem CID 47103944) has the molecular formula C15H16FNO2S and a molecular weight of 293.36 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N,3-dimethylbenzenesulfonamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N,3-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 47103944 |
| Molecular Formula | C15H16FNO2S |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N,3-dimethylbenzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)N(C)Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C15H16FNO2S/c1-12-4-3-5-15(10-12)20(18,19)17(2)11-13-6-8-14(16)9-7-13/h3-10H,11H2,1-2H3 |
| InChIKey | LSIWJBAASKWNHC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |