C10H16N2O2S — CID 28707580
N-(2-aminoethyl)-N,3-dimethylbenzenesulfonamide (PubChem CID 28707580) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is N-(2-aminoethyl)-N,3-dimethylbenzenesulfonamide.
| Compound Name | N-(2-aminoethyl)-N,3-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 28707580 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | N-(2-aminoethyl)-N,3-dimethylbenzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)N(C)CCN)c1 |
| InChI | InChI=1S/C10H16N2O2S/c1-9-4-3-5-10(8-9)15(13,14)12(2)7-6-11/h3-5,8H,6-7,11H2,1-2H3 |
| InChIKey | ZPIHQTFSUANING-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |