C17H25N3O4S — CID 131930163
N-[(3-methoxyphenyl)methyl]-N-(3-methoxypropyl)-1,3-dimethylpyrazole-4-sulfonamide (PubChem CID 131930163) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-N-(3-methoxypropyl)-1,3-dimethylpyrazole-4-sulfonamide.
| Compound Name | N-[(3-methoxyphenyl)methyl]-N-(3-methoxypropyl)-1,3-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 131930163 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-N-(3-methoxypropyl)-1,3-dimethylpyrazole-4-sulfonamide |
| SMILES | COCCCN(Cc1cccc(OC)c1)S(=O)(=O)c1cn(C)nc1C |
| InChI | InChI=1S/C17H25N3O4S/c1-14-17(13-19(2)18-14)25(21,22)20(9-6-10-23-3)12-15-7-5-8-16(11-15)24-4/h5,7-8,11,13H,6,9-10,12H2,1-4H3 |
| InChIKey | WXDDKIOZTGBTQS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|