C30H24F3NO7S2 — CID 3398056
[5-[[furan-2-ylmethyl(naphthalen-1-ylsulfonyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 3398056) has the molecular formula C30H24F3NO7S2 and a molecular weight of 631.65 g/mol. Its IUPAC name is [5-[[furan-2-ylmethyl(naphthalen-1-ylsulfonyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [5-[[furan-2-ylmethyl(naphthalen-1-ylsulfonyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 3398056 |
| Molecular Formula | C30H24F3NO7S2 |
| Molecular Weight | 631.65 g/mol |
| Exact Mass | 631.09 |
| IUPAC Name | [5-[[furan-2-ylmethyl(naphthalen-1-ylsulfonyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | COc1ccc(CN(Cc2ccco2)S(=O)(=O)c2cccc3ccccc23)cc1OS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H24F3NO7S2/c1-39-27-15-14-21(17-28(27)41-43(37,38)25-11-5-9-23(18-25)30(31,32)33)19-34(20-24-10-6-16-40-24)42(35,36)29-13-4-8-22-7-2-3-12-26(22)29/h2-18H,19-20H2,1H3 |
| InChIKey | DLBMSBSTNBWZNY-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.65 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|