C19H31NO4S — CID 4574820
[3-[[hexanoyl(2-methylpropyl)amino]methyl]phenyl] ethanesulfonate (PubChem CID 4574820) has the molecular formula C19H31NO4S and a molecular weight of 369.53 g/mol. Its IUPAC name is [3-[[hexanoyl(2-methylpropyl)amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [3-[[hexanoyl(2-methylpropyl)amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 4574820 |
| Molecular Formula | C19H31NO4S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | [3-[[hexanoyl(2-methylpropyl)amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCCCCC(=O)N(Cc1cccc(OS(=O)(=O)CC)c1)CC(C)C |
| InChI | InChI=1S/C19H31NO4S/c1-5-7-8-12-19(21)20(14-16(3)4)15-17-10-9-11-18(13-17)24-25(22,23)6-2/h9-11,13,16H,5-8,12,14-15H2,1-4H3 |
| InChIKey | KFZHGSJZJJLFDM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|