C25H31N3O4 — CID 42817244
N-[4-(dimethylamino)-3-[[2-ethylbutanoyl(furan-2-ylmethyl)amino]methyl]phenyl]furan-2-carboxamide (PubChem CID 42817244) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-[4-(dimethylamino)-3-[[2-ethylbutanoyl(furan-2-ylmethyl)amino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-(dimethylamino)-3-[[2-ethylbutanoyl(furan-2-ylmethyl)amino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42817244 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | N-[4-(dimethylamino)-3-[[2-ethylbutanoyl(furan-2-ylmethyl)amino]methyl]phenyl]furan-2-carboxamide |
| SMILES | CCC(CC)C(=O)N(Cc1ccco1)Cc1cc(NC(=O)c2ccco2)ccc1N(C)C |
| InChI | InChI=1S/C25H31N3O4/c1-5-18(6-2)25(30)28(17-21-9-7-13-31-21)16-19-15-20(11-12-22(19)27(3)4)26-24(29)23-10-8-14-32-23/h7-15,18H,5-6,16-17H2,1-4H3,(H,26,29) |
| InChIKey | FPLIXKWHTYAILX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 78.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|