C22H31N3O3 — CID 42815648
N-[4-(dimethylamino)-3-[[furan-2-ylmethyl(2-methylpropanoyl)amino]methyl]phenyl]-2-methylpropanamide (PubChem CID 42815648) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-[4-(dimethylamino)-3-[[furan-2-ylmethyl(2-methylpropanoyl)amino]methyl]phenyl]-2-methylpropanamide.
| Compound Name | N-[4-(dimethylamino)-3-[[furan-2-ylmethyl(2-methylpropanoyl)amino]methyl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 42815648 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | N-[4-(dimethylamino)-3-[[furan-2-ylmethyl(2-methylpropanoyl)amino]methyl]phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1ccc(N(C)C)c(CN(Cc2ccco2)C(=O)C(C)C)c1 |
| InChI | InChI=1S/C22H31N3O3/c1-15(2)21(26)23-18-9-10-20(24(5)6)17(12-18)13-25(22(27)16(3)4)14-19-8-7-11-28-19/h7-12,15-16H,13-14H2,1-6H3,(H,23,26) |
| InChIKey | YAOKDTSACKFICL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|