C23H28N4O3S — CID 46138548
N-[4-(dimethylamino)-3-[[furan-2-ylmethyl(propan-2-ylcarbamoyl)amino]methyl]phenyl]thiophene-2-carboxamide (PubChem CID 46138548) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is N-[4-(dimethylamino)-3-[[furan-2-ylmethyl(propan-2-ylcarbamoyl)amino]methyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-(dimethylamino)-3-[[furan-2-ylmethyl(propan-2-ylcarbamoyl)amino]methyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46138548 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | N-[4-(dimethylamino)-3-[[furan-2-ylmethyl(propan-2-ylcarbamoyl)amino]methyl]phenyl]thiophene-2-carboxamide |
| SMILES | CC(C)NC(=O)N(Cc1ccco1)Cc1cc(NC(=O)c2cccs2)ccc1N(C)C |
| InChI | InChI=1S/C23H28N4O3S/c1-16(2)24-23(29)27(15-19-7-5-11-30-19)14-17-13-18(9-10-20(17)26(3)4)25-22(28)21-8-6-12-31-21/h5-13,16H,14-15H2,1-4H3,(H,24,29)(H,25,28) |
| InChIKey | YMZVACPZAMSPRY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|