C22H27N3O4S2 — CID 42817226
N-[[2-(dimethylamino)-5-(propylsulfonylamino)phenyl]methyl]-N-(furan-2-ylmethyl)thiophene-2-carboxamide (PubChem CID 42817226) has the molecular formula C22H27N3O4S2 and a molecular weight of 461.61 g/mol. Its IUPAC name is N-[[2-(dimethylamino)-5-(propylsulfonylamino)phenyl]methyl]-N-(furan-2-ylmethyl)thiophene-2-carboxamide.
| Compound Name | N-[[2-(dimethylamino)-5-(propylsulfonylamino)phenyl]methyl]-N-(furan-2-ylmethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 42817226 |
| Molecular Formula | C22H27N3O4S2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | N-[[2-(dimethylamino)-5-(propylsulfonylamino)phenyl]methyl]-N-(furan-2-ylmethyl)thiophene-2-carboxamide |
| SMILES | CCCS(=O)(=O)Nc1ccc(N(C)C)c(CN(Cc2ccco2)C(=O)c2cccs2)c1 |
| InChI | InChI=1S/C22H27N3O4S2/c1-4-13-31(27,28)23-18-9-10-20(24(2)3)17(14-18)15-25(16-19-7-5-11-29-19)22(26)21-8-6-12-30-21/h5-12,14,23H,4,13,15-16H2,1-3H3 |
| InChIKey | MTHKQITWUVVWQA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|