C22H34N4O4S — CID 42817233
3-tert-butyl-1-[[2-(dimethylamino)-5-(propylsulfonylamino)phenyl]methyl]-1-(furan-2-ylmethyl)urea (PubChem CID 42817233) has the molecular formula C22H34N4O4S and a molecular weight of 450.61 g/mol. Its IUPAC name is 3-tert-butyl-1-[[2-(dimethylamino)-5-(propylsulfonylamino)phenyl]methyl]-1-(furan-2-ylmethyl)urea.
| Compound Name | 3-tert-butyl-1-[[2-(dimethylamino)-5-(propylsulfonylamino)phenyl]methyl]-1-(furan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 42817233 |
| Molecular Formula | C22H34N4O4S |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 3-tert-butyl-1-[[2-(dimethylamino)-5-(propylsulfonylamino)phenyl]methyl]-1-(furan-2-ylmethyl)urea |
| SMILES | CCCS(=O)(=O)Nc1ccc(N(C)C)c(CN(Cc2ccco2)C(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C22H34N4O4S/c1-7-13-31(28,29)24-18-10-11-20(25(5)6)17(14-18)15-26(16-19-9-8-12-30-19)21(27)23-22(2,3)4/h8-12,14,24H,7,13,15-16H2,1-6H3,(H,23,27) |
| InChIKey | GOCUYHRVLKEUEA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|