C25H37N3O4S — CID 42816898
N-[[2-(dimethylamino)-5-(propylsulfonylamino)phenyl]methyl]-N-(2-methoxyethyl)-2-phenylbutanamide (PubChem CID 42816898) has the molecular formula C25H37N3O4S and a molecular weight of 475.66 g/mol. Its IUPAC name is N-[[2-(dimethylamino)-5-(propylsulfonylamino)phenyl]methyl]-N-(2-methoxyethyl)-2-phenylbutanamide.
| Compound Name | N-[[2-(dimethylamino)-5-(propylsulfonylamino)phenyl]methyl]-N-(2-methoxyethyl)-2-phenylbutanamide |
|---|---|
| PubChem CID | 42816898 |
| Molecular Formula | C25H37N3O4S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | N-[[2-(dimethylamino)-5-(propylsulfonylamino)phenyl]methyl]-N-(2-methoxyethyl)-2-phenylbutanamide |
| SMILES | CCCS(=O)(=O)Nc1ccc(N(C)C)c(CN(CCOC)C(=O)C(CC)c2ccccc2)c1 |
| InChI | InChI=1S/C25H37N3O4S/c1-6-17-33(30,31)26-22-13-14-24(27(3)4)21(18-22)19-28(15-16-32-5)25(29)23(7-2)20-11-9-8-10-12-20/h8-14,18,23,26H,6-7,15-17,19H2,1-5H3 |
| InChIKey | VHJOIMUDEGPECU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|