C26H37N3O3 — CID 42882328
N-[4-(dimethylamino)-3-[[2-ethylbutanoyl(propyl)amino]methyl]phenyl]-2-methoxybenzamide (PubChem CID 42882328) has the molecular formula C26H37N3O3 and a molecular weight of 439.60 g/mol. Its IUPAC name is N-[4-(dimethylamino)-3-[[2-ethylbutanoyl(propyl)amino]methyl]phenyl]-2-methoxybenzamide.
| Compound Name | N-[4-(dimethylamino)-3-[[2-ethylbutanoyl(propyl)amino]methyl]phenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 42882328 |
| Molecular Formula | C26H37N3O3 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | N-[4-(dimethylamino)-3-[[2-ethylbutanoyl(propyl)amino]methyl]phenyl]-2-methoxybenzamide |
| SMILES | CCCN(Cc1cc(NC(=O)c2ccccc2OC)ccc1N(C)C)C(=O)C(CC)CC |
| InChI | InChI=1S/C26H37N3O3/c1-7-16-29(26(31)19(8-2)9-3)18-20-17-21(14-15-23(20)28(4)5)27-25(30)22-12-10-11-13-24(22)32-6/h10-15,17,19H,7-9,16,18H2,1-6H3,(H,27,30) |
| InChIKey | XGLIMHAXLIDBRF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|