C26H24N4O5S — CID 46111062
N-[[2-(dimethylamino)-5-[(4-nitrobenzoyl)amino]phenyl]methyl]-N-(furan-2-ylmethyl)thiophene-2-carboxamide (PubChem CID 46111062) has the molecular formula C26H24N4O5S and a molecular weight of 504.57 g/mol. Its IUPAC name is N-[[2-(dimethylamino)-5-[(4-nitrobenzoyl)amino]phenyl]methyl]-N-(furan-2-ylmethyl)thiophene-2-carboxamide.
| Compound Name | N-[[2-(dimethylamino)-5-[(4-nitrobenzoyl)amino]phenyl]methyl]-N-(furan-2-ylmethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46111062 |
| Molecular Formula | C26H24N4O5S |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | N-[[2-(dimethylamino)-5-[(4-nitrobenzoyl)amino]phenyl]methyl]-N-(furan-2-ylmethyl)thiophene-2-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)c2ccc([N+](=O)[O-])cc2)cc1CN(Cc1ccco1)C(=O)c1cccs1 |
| InChI | InChI=1S/C26H24N4O5S/c1-28(2)23-12-9-20(27-25(31)18-7-10-21(11-8-18)30(33)34)15-19(23)16-29(17-22-5-3-13-35-22)26(32)24-6-4-14-36-24/h3-15H,16-17H2,1-2H3,(H,27,31) |
| InChIKey | CCKMNSAQBZSMAN-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|