C25H35N3O3 — CID 42817047
N-[3-[[cyclohexyl(2,2-dimethylpropanoyl)amino]methyl]-4-(dimethylamino)phenyl]furan-2-carboxamide (PubChem CID 42817047) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is N-[3-[[cyclohexyl(2,2-dimethylpropanoyl)amino]methyl]-4-(dimethylamino)phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[cyclohexyl(2,2-dimethylpropanoyl)amino]methyl]-4-(dimethylamino)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42817047 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | N-[3-[[cyclohexyl(2,2-dimethylpropanoyl)amino]methyl]-4-(dimethylamino)phenyl]furan-2-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)c2ccco2)cc1CN(C(=O)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C25H35N3O3/c1-25(2,3)24(30)28(20-10-7-6-8-11-20)17-18-16-19(13-14-21(18)27(4)5)26-23(29)22-12-9-15-31-22/h9,12-16,20H,6-8,10-11,17H2,1-5H3,(H,26,29) |
| InChIKey | GICGQMRINQNDOW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|