C28H38N4O6 — CID 131965878
2-[(4S)-4-[(4-tert-butylphenyl)methyl]-3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-6-yl]acetic acid (PubChem CID 131965878) has the molecular formula C28H38N4O6 and a molecular weight of 526.63 g/mol. Its IUPAC name is 2-[(4S)-4-[(4-tert-butylphenyl)methyl]-3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-6-yl]acetic acid.
| Compound Name | 2-[(4S)-4-[(4-tert-butylphenyl)methyl]-3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-6-yl]acetic acid |
|---|---|
| PubChem CID | 131965878 |
| Molecular Formula | C28H38N4O6 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | 2-[(4S)-4-[(4-tert-butylphenyl)methyl]-3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-6-yl]acetic acid |
| SMILES | CC(C)(C)c1ccc(C[C@H]2CN(CC(=O)O)CCN(CC(=O)O)Cc3cccc(n3)CN2CC(=O)O)cc1 |
| InChI | InChI=1S/C28H38N4O6/c1-28(2,3)21-9-7-20(8-10-21)13-24-16-31(18-26(35)36)12-11-30(17-25(33)34)14-22-5-4-6-23(29-22)15-32(24)19-27(37)38/h4-10,24H,11-19H2,1-3H3,(H,33,34)(H,35,36)(H,37,38)/t24-/m0/s1 |
| InChIKey | BEBMBSMIVVIZBW-DEOSSOPVSA-N |
| XLogP | 2.16 |
| TPSA | 134.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |