C23H32N5O9-3 — CID 58085166
2-[3,9-bis(carboxylatomethyl)-12-[3-(2,3-dihydroxypropylamino)-3-oxopropyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]acetate (PubChem CID 58085166) has the molecular formula C23H32N5O9-3 and a molecular weight of 522.54 g/mol. Its IUPAC name is 2-[3,9-bis(carboxylatomethyl)-12-[3-(2,3-dihydroxypropylamino)-3-oxopropyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]acetate.
| Compound Name | 2-[3,9-bis(carboxylatomethyl)-12-[3-(2,3-dihydroxypropylamino)-3-oxopropyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]acetate |
|---|---|
| PubChem CID | 58085166 |
| Molecular Formula | C23H32N5O9-3 |
| Molecular Weight | 522.54 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | 2-[3,9-bis(carboxylatomethyl)-12-[3-(2,3-dihydroxypropylamino)-3-oxopropyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]acetate |
| SMILES | O=C([O-])CN1CCN(CC(=O)[O-])Cc2ccc(CCC(=O)NCC(O)CO)c(n2)CN(CC(=O)[O-])CC1 |
| InChI | InChI=1S/C23H35N5O9/c29-15-18(30)9-24-20(31)4-2-16-1-3-17-10-27(13-22(34)35)7-5-26(12-21(32)33)6-8-28(14-23(36)37)11-19(16)25-17/h1,3,18,29-30H,2,4-15H2,(H,24,31)(H,32,33)(H,34,35)(H,36,37)/p-3 |
| InChIKey | BRFSVAZMRGZFPV-UHFFFAOYSA-K |
| XLogP | -6.35 |
| TPSA | 212.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.54 |
| LogP ≤ 5 | -6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |