C22H32N4O8 — CID 171086981
2-[3,9-bis(carboxymethyl)-12-(3-methyl-2-oxobutoxy)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]acetic acid (PubChem CID 171086981) has the molecular formula C22H32N4O8 and a molecular weight of 480.52 g/mol. Its IUPAC name is 2-[3,9-bis(carboxymethyl)-12-(3-methyl-2-oxobutoxy)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]acetic acid.
| Compound Name | 2-[3,9-bis(carboxymethyl)-12-(3-methyl-2-oxobutoxy)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]acetic acid |
|---|---|
| PubChem CID | 171086981 |
| Molecular Formula | C22H32N4O8 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 2-[3,9-bis(carboxymethyl)-12-(3-methyl-2-oxobutoxy)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]acetic acid |
| SMILES | CC(C)C(=O)COc1ccc2nc1CN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)C2 |
| InChI | InChI=1S/C22H32N4O8/c1-15(2)18(27)14-34-19-4-3-16-9-25(12-21(30)31)7-5-24(11-20(28)29)6-8-26(13-22(32)33)10-17(19)23-16/h3-4,15H,5-14H2,1-2H3,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | DHJQKHSMYXRYIF-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 160.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |