C22H33N5O8 — CID 58085161
2-[3,9-bis(carboxymethyl)-12-[3-(2-hydroxyethylamino)-3-oxopropyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]acetic acid (PubChem CID 58085161) has the molecular formula C22H33N5O8 and a molecular weight of 495.53 g/mol. Its IUPAC name is 2-[3,9-bis(carboxymethyl)-12-[3-(2-hydroxyethylamino)-3-oxopropyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]acetic acid.
| Compound Name | 2-[3,9-bis(carboxymethyl)-12-[3-(2-hydroxyethylamino)-3-oxopropyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]acetic acid |
|---|---|
| PubChem CID | 58085161 |
| Molecular Formula | C22H33N5O8 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 2-[3,9-bis(carboxymethyl)-12-[3-(2-hydroxyethylamino)-3-oxopropyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)Cc2ccc(CCC(=O)NCCO)c(n2)CN(CC(=O)O)CC1 |
| InChI | InChI=1S/C22H33N5O8/c28-10-5-23-19(29)4-2-16-1-3-17-11-26(14-21(32)33)8-6-25(13-20(30)31)7-9-27(15-22(34)35)12-18(16)24-17/h1,3,28H,2,4-15H2,(H,23,29)(H,30,31)(H,32,33)(H,34,35) |
| InChIKey | NKUKQCWKCGARMV-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 183.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |