C36H58N6O15 — CID 138514586
2-[3,9-bis[1-carboxy-4-(2,3-dihydroxypropylamino)-4-oxobutyl]-3,9,15-triazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]-5-(2,3-dihydroxypropylamino)-5-oxopentanoic acid (PubChem CID 138514586) has the molecular formula C36H58N6O15 and a molecular weight of 814.89 g/mol. Its IUPAC name is 2-[3,9-bis[1-carboxy-4-(2,3-dihydroxypropylamino)-4-oxobutyl]-3,9,15-triazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]-5-(2,3-dihydroxypropylamino)-5-oxopentanoic acid.
| Compound Name | 2-[3,9-bis[1-carboxy-4-(2,3-dihydroxypropylamino)-4-oxobutyl]-3,9,15-triazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]-5-(2,3-dihydroxypropylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 138514586 |
| Molecular Formula | C36H58N6O15 |
| Molecular Weight | 814.89 g/mol |
| Exact Mass | 814.40 |
| IUPAC Name | 2-[3,9-bis[1-carboxy-4-(2,3-dihydroxypropylamino)-4-oxobutyl]-3,9,15-triazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]-5-(2,3-dihydroxypropylamino)-5-oxopentanoic acid |
| SMILES | O=C(CCC(C(=O)O)C1CCN(C(CCC(=O)NCC(O)CO)C(=O)O)Cc2cccc(n2)CN(C(CCC(=O)NCC(O)CO)C(=O)O)CC1)NCC(O)CO |
| InChI | InChI=1S/C36H58N6O15/c43-19-25(46)14-37-31(49)7-4-28(34(52)53)22-10-12-41(29(35(54)55)5-8-32(50)38-15-26(47)20-44)17-23-2-1-3-24(40-23)18-42(13-11-22)30(36(56)57)6-9-33(51)39-16-27(48)21-45/h1-3,22,25-30,43-48H,4-21H2,(H,37,49)(H,38,50)(H,39,51)(H,52,53)(H,54,55)(H,56,57) |
| InChIKey | UHUFGVPTVWUBRX-UHFFFAOYSA-N |
| XLogP | -3.55 |
| TPSA | 339.95 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.89 |
| LogP ≤ 5 | -3.55 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 15 |