C14H22FN3 — CID 117111789
2-fluoro-N,N-dimethyl-5-(2-piperazin-1-ylethyl)aniline (PubChem CID 117111789) has the molecular formula C14H22FN3 and a molecular weight of 251.35 g/mol. Its IUPAC name is 2-fluoro-N,N-dimethyl-5-(2-piperazin-1-ylethyl)aniline.
| Compound Name | 2-fluoro-N,N-dimethyl-5-(2-piperazin-1-ylethyl)aniline |
|---|---|
| PubChem CID | 117111789 |
| Molecular Formula | C14H22FN3 |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.18 |
| IUPAC Name | 2-fluoro-N,N-dimethyl-5-(2-piperazin-1-ylethyl)aniline |
| SMILES | CN(C)c1cc(CCN2CCNCC2)ccc1F |
| InChI | InChI=1S/C14H22FN3/c1-17(2)14-11-12(3-4-13(14)15)5-8-18-9-6-16-7-10-18/h3-4,11,16H,5-10H2,1-2H3 |
| InChIKey | VYAMMYQSKXZUAD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |