C13H18ClFN2 — CID 81154666
1-[(3-chloro-4-fluorophenyl)methyl]-2,2-dimethylpiperazine (PubChem CID 81154666) has the molecular formula C13H18ClFN2 and a molecular weight of 256.75 g/mol. Its IUPAC name is 1-[(3-chloro-4-fluorophenyl)methyl]-2,2-dimethylpiperazine.
| Compound Name | 1-[(3-chloro-4-fluorophenyl)methyl]-2,2-dimethylpiperazine |
|---|---|
| PubChem CID | 81154666 |
| Molecular Formula | C13H18ClFN2 |
| Molecular Weight | 256.75 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 1-[(3-chloro-4-fluorophenyl)methyl]-2,2-dimethylpiperazine |
| SMILES | CC1(C)CNCCN1Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H18ClFN2/c1-13(2)9-16-5-6-17(13)8-10-3-4-12(15)11(14)7-10/h3-4,7,16H,5-6,8-9H2,1-2H3 |
| InChIKey | CCWZRORDICWFEF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.75 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |