About 6-[(2,2-dimethylpiperazin-1-yl)methyl]-2-methylquinoline
6-[(2,2-dimethylpiperazin-1-yl)methyl]-2-methylquinoline (PubChem CID 105379001) has the molecular formula C17H23N3
and a molecular weight of 269.39 g/mol. Its IUPAC name is 6-[(2,2-dimethylpiperazin-1-yl)methyl]-2-methylquinoline.
Molecular Properties
| Compound Name | 6-[(2,2-dimethylpiperazin-1-yl)methyl]-2-methylquinoline |
| PubChem CID | 105379001 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 6-[(2,2-dimethylpiperazin-1-yl)methyl]-2-methylquinoline |
| SMILES | Cc1ccc2cc(CN3CCNCC3(C)C)ccc2n1 |
| InChI | InChI=1S/C17H23N3/c1-13-4-6-15-10-14(5-7-16(15)19-13)11-20-9-8-18-12-17(20,2)3/h4-7,10,18H,8-9,11-12H2,1-3H3 |
| InChIKey | SOVQBGLAUSUSNL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[(2,2-dimethylpiperazin-1-yl)methyl]-2-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2,2-dimethylpiperazin-1-yl)methyl]-2-methylquinoline?
The IUPAC name of 6-[(2,2-dimethylpiperazin-1-yl)methyl]-2-methylquinoline (CID 105379001) is 6-[(2,2-dimethylpiperazin-1-yl)methyl]-2-methylquinoline.
What is the SMILES notation for 6-[(2,2-dimethylpiperazin-1-yl)methyl]-2-methylquinoline?
The canonical SMILES for 6-[(2,2-dimethylpiperazin-1-yl)methyl]-2-methylquinoline is Cc1ccc2cc(CN3CCNCC3(C)C)ccc2n1.
What is the InChIKey of 6-[(2,2-dimethylpiperazin-1-yl)methyl]-2-methylquinoline?
The InChIKey is SOVQBGLAUSUSNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3/c1-13-4-6-15-10-14(5-7-16(15)19-13)11-20-9-8-18-12-17(20,2)3/h4-7,10,18H,8-9,11-12H2,1-3H3.
What are the key properties of 6-[(2,2-dimethylpiperazin-1-yl)methyl]-2-methylquinoline?
6-[(2,2-dimethylpiperazin-1-yl)methyl]-2-methylquinoline has a molecular weight of 269.39 g/mol, XLogP of 2.73, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2,2-dimethylpiperazin-1-yl)methyl]-2-methylquinoline is sourced from PubChem (CID 105379001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).